C28H33Cl2N3O3 — CID 76775247
4-[4-[[4,6-dichloro-2-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 76775247) has the molecular formula C28H33Cl2N3O3 and a molecular weight of 530.50 g/mol. Its IUPAC name is 4-[4-[[4,6-dichloro-2-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-[[4,6-dichloro-2-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 76775247 |
| Molecular Formula | C28H33Cl2N3O3 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 4-[4-[[4,6-dichloro-2-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COCCN1CCCN(C2Cc3c(Cl)cc(Cl)cc3C2Oc2ccc(-c3c(C)noc3C)cc2)CC1 |
| InChI | InChI=1S/C28H33Cl2N3O3/c1-18-27(19(2)36-31-18)20-5-7-22(8-6-20)35-28-24-15-21(29)16-25(30)23(24)17-26(28)33-10-4-9-32(11-12-33)13-14-34-3/h5-8,15-16,26,28H,4,9-14,17H2,1-3H3 |
| InChIKey | QYJZHGTTZMVIDY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |