C24H26Cl2N4O3 — CID 67311187
2-[4-[[(1S,2R)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-4-ethyl-5-methyl-1,2,4-triazol-3-one (PubChem CID 67311187) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 2-[4-[[(1S,2R)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-4-ethyl-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-[[(1S,2R)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-4-ethyl-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 67311187 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[4-[[(1S,2R)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-4-ethyl-5-methyl-1,2,4-triazol-3-one |
| SMILES | CCn1c(C)nn(-c2ccc(O[C@H]3c4cc(Cl)cc(Cl)c4C[C@H]3N3CC[C@@H](O)C3)cc2)c1=O |
| InChI | InChI=1S/C24H26Cl2N4O3/c1-3-29-14(2)27-30(24(29)32)16-4-6-18(7-5-16)33-23-20-10-15(25)11-21(26)19(20)12-22(23)28-9-8-17(31)13-28/h4-7,10-11,17,22-23,31H,3,8-9,12-13H2,1-2H3/t17-,22-,23+/m1/s1 |
| InChIKey | BUVDOSADKRUXSU-ZQMYSKGWSA-N |
| XLogP | 3.78 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |