C26H30Cl2N4O2 — CID 67310324
1-[(1S,2S)-4,6-dichloro-1-[4-(3-ethyl-5-propan-2-yl-1,2,4-triazol-4-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol (PubChem CID 67310324) has the molecular formula C26H30Cl2N4O2 and a molecular weight of 501.46 g/mol. Its IUPAC name is 1-[(1S,2S)-4,6-dichloro-1-[4-(3-ethyl-5-propan-2-yl-1,2,4-triazol-4-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol.
| Compound Name | 1-[(1S,2S)-4,6-dichloro-1-[4-(3-ethyl-5-propan-2-yl-1,2,4-triazol-4-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 67310324 |
| Molecular Formula | C26H30Cl2N4O2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 1-[(1S,2S)-4,6-dichloro-1-[4-(3-ethyl-5-propan-2-yl-1,2,4-triazol-4-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
| SMILES | CCc1nnc(C(C)C)n1-c1ccc(O[C@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N2CCC(O)C2)cc1 |
| InChI | InChI=1S/C26H30Cl2N4O2/c1-4-24-29-30-26(15(2)3)32(24)17-5-7-19(8-6-17)34-25-21-11-16(27)12-22(28)20(21)13-23(25)31-10-9-18(33)14-31/h5-8,11-12,15,18,23,25,33H,4,9-10,13-14H2,1-3H3/t18?,23-,25-/m0/s1 |
| InChIKey | WVFGHGDMJFOPAC-BOQFIEIISA-N |
| XLogP | 5.37 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |