C10H14F3N2+ — CID 76787438
1-[6-(trifluoromethyl)-2-pyridinyl]butylazanium (PubChem CID 76787438) has the molecular formula C10H14F3N2+ and a molecular weight of 219.23 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-2-pyridinyl]butylazanium.
| Compound Name | 1-[6-(trifluoromethyl)-2-pyridinyl]butylazanium |
|---|---|
| PubChem CID | 76787438 |
| Molecular Formula | C10H14F3N2+ |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-[6-(trifluoromethyl)-2-pyridinyl]butylazanium |
| SMILES | CCCC([NH3+])c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2/c1-2-4-7(14)8-5-3-6-9(15-8)10(11,12)13/h3,5-7H,2,4,14H2,1H3/p+1 |
| InChIKey | NJRLOYLAMJQUKW-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |