C26H29Cl2N4P — CID 76796474
bis[2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-phenylphosphane (PubChem CID 76796474) has the molecular formula C26H29Cl2N4P and a molecular weight of 499.43 g/mol. Its IUPAC name is bis[2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-phenylphosphane.
| Compound Name | bis[2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-phenylphosphane |
|---|---|
| PubChem CID | 76796474 |
| Molecular Formula | C26H29Cl2N4P |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | bis[2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-phenylphosphane |
| SMILES | CN1CCCC1c1cnc(Cl)cc1P(c1ccccc1)c1cc(Cl)ncc1C1CCCN1C |
| InChI | InChI=1S/C26H29Cl2N4P/c1-31-12-6-10-21(31)19-16-29-25(27)14-23(19)33(18-8-4-3-5-9-18)24-15-26(28)30-17-20(24)22-11-7-13-32(22)2/h3-5,8-9,14-17,21-22H,6-7,10-13H2,1-2H3 |
| InChIKey | YMROLJNPWCOWQI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|