C9H8BrNO3 — CID 76800437
N-[(5-bromo-2-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine (PubChem CID 76800437) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is N-[(5-bromo-2-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine.
| Compound Name | N-[(5-bromo-2-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 76800437 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | N-[(5-bromo-2-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
| SMILES | CC1Oc2ccc(Br)c(C=NO)c2O1 |
| InChI | InChI=1S/C9H8BrNO3/c1-5-13-8-3-2-7(10)6(4-11-12)9(8)14-5/h2-5,12H,1H3 |
| InChIKey | QTBFFDGXQQUJJS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|