C22H22O2 — CID 76808013
4-hydroxy-3-[2-methyl-5-(3-methylphenyl)phenyl]bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 76808013) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-hydroxy-3-[2-methyl-5-(3-methylphenyl)phenyl]bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 4-hydroxy-3-[2-methyl-5-(3-methylphenyl)phenyl]bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 76808013 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-hydroxy-3-[2-methyl-5-(3-methylphenyl)phenyl]bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | Cc1cccc(-c2ccc(C)c(C3=C(O)C4CCC(C4)C3=O)c2)c1 |
| InChI | InChI=1S/C22H22O2/c1-13-4-3-5-15(10-13)16-7-6-14(2)19(12-16)20-21(23)17-8-9-18(11-17)22(20)24/h3-7,10,12,17-18,23H,8-9,11H2,1-2H3 |
| InChIKey | QHDMYFHDEFTNJQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |