C24H24BCl2FN6O — CID 76815122
[4-[4-[1-[1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidin-1-yl]-methylborinic acid (PubChem CID 76815122) has the molecular formula C24H24BCl2FN6O and a molecular weight of 513.21 g/mol. Its IUPAC name is [4-[4-[1-[1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[4-[1-[1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 76815122 |
| Molecular Formula | C24H24BCl2FN6O |
| Molecular Weight | 513.21 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | [4-[4-[1-[1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(n2cc(-c3cnc4ccn(N=C(C)c5c(Cl)ccc(F)c5Cl)c4c3)cn2)CC1 |
| InChI | InChI=1S/C24H24BCl2FN6O/c1-15(23-19(26)3-4-20(28)24(23)27)31-33-10-7-21-22(33)11-16(12-29-21)17-13-30-34(14-17)18-5-8-32(9-6-18)25(2)35/h3-4,7,10-14,18,35H,5-6,8-9H2,1-2H3 |
| InChIKey | UGCJXOUKJGQZIS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.21 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|