C21H35NO6 — CID 76815730
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-hydroxy-2-methylpropan-2-yl)carbamate (PubChem CID 76815730) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-hydroxy-2-methylpropan-2-yl)carbamate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-hydroxy-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 76815730 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-hydroxy-2-methylpropan-2-yl)carbamate |
| SMILES | COC1C(OC(=O)NC(C)(C)CO)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C21H35NO6/c1-13(2)7-8-15-20(5,28-15)17-16(25-6)14(9-10-21(17)12-26-21)27-18(24)22-19(3,4)11-23/h7,14-17,23H,8-12H2,1-6H3,(H,22,24) |
| InChIKey | AFSOHIIZXYEGPU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|