C22H37NO6 — CID 10273058
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate (PubChem CID 10273058) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10273058 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N[C@@H](CO)C(C)C)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C22H37NO6/c1-13(2)7-8-17-21(5,29-17)19-18(26-6)16(9-10-22(19)12-27-22)28-20(25)23-15(11-24)14(3)4/h7,14-19,24H,8-12H2,1-6H3,(H,23,25)/t15-,16+,17+,18+,19+,21+,22-/m0/s1 |
| InChIKey | FNICYDIIQRVZKR-DQPSUAHJSA-N |
| XLogP | 2.81 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|