C24H38N4O5S — CID 142752348
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2S)-1-(5-amino-1,3,4-thiadiazol-2-yl)-3-methylbutan-2-yl]carbamate (PubChem CID 142752348) has the molecular formula C24H38N4O5S and a molecular weight of 494.66 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2S)-1-(5-amino-1,3,4-thiadiazol-2-yl)-3-methylbutan-2-yl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2S)-1-(5-amino-1,3,4-thiadiazol-2-yl)-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142752348 |
| Molecular Formula | C24H38N4O5S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2S)-1-(5-amino-1,3,4-thiadiazol-2-yl)-3-methylbutan-2-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N[C@@H](Cc2nnc(N)s2)C(C)C)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C24H38N4O5S/c1-13(2)7-8-17-23(5,33-17)20-19(30-6)16(9-10-24(20)12-31-24)32-22(29)26-15(14(3)4)11-18-27-28-21(25)34-18/h7,14-17,19-20H,8-12H2,1-6H3,(H2,25,28)(H,26,29)/t15-,16+,17+,19+,20+,23-,24-/m0/s1 |
| InChIKey | BJVKFFKSQFLOCQ-UDWWEWHTSA-N |
| XLogP | 3.49 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|