C26H45N3O6 — CID 10228513
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[2-(dimethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10228513) has the molecular formula C26H45N3O6 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[2-(dimethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[2-(dimethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10228513 |
| Molecular Formula | C26H45N3O6 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[2-(dimethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N[C@@H](C(=O)NCCN(C)C)C(C)C)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C26H45N3O6/c1-16(2)9-10-19-25(5,35-19)22-21(32-8)18(11-12-26(22)15-33-26)34-24(31)28-20(17(3)4)23(30)27-13-14-29(6)7/h9,17-22H,10-15H2,1-8H3,(H,27,30)(H,28,31)/t18-,19-,20-,21-,22-,25-,26+/m1/s1 |
| InChIKey | JTPNUQVXWGAPPK-YXOZMWBCSA-N |
| XLogP | 2.49 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|