C31H51N3O6 — CID 10166530
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(4-pyrrolidin-1-ylpiperidin-1-yl)butan-2-yl]carbamate (PubChem CID 10166530) has the molecular formula C31H51N3O6 and a molecular weight of 561.76 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(4-pyrrolidin-1-ylpiperidin-1-yl)butan-2-yl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(4-pyrrolidin-1-ylpiperidin-1-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 10166530 |
| Molecular Formula | C31H51N3O6 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(4-pyrrolidin-1-ylpiperidin-1-yl)butan-2-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N[C@@H](C(=O)N2CCC(N3CCCC3)CC2)C(C)C)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C31H51N3O6/c1-20(2)9-10-24-30(5,40-24)27-26(37-6)23(11-14-31(27)19-38-31)39-29(36)32-25(21(3)4)28(35)34-17-12-22(13-18-34)33-15-7-8-16-33/h9,21-27H,7-8,10-19H2,1-6H3,(H,32,36)/t23-,24-,25-,26-,27-,30-,31+/m1/s1 |
| InChIKey | UOYGEXIZBFVSDX-XJCLYHHNSA-N |
| XLogP | 3.90 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|