C31H39F3N4O3Si — CID 76819391
1-[3-[tert-butyl(dimethyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]-3-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]piperidin-2-one (PubChem CID 76819391) has the molecular formula C31H39F3N4O3Si and a molecular weight of 600.76 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]-3-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]piperidin-2-one.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]-3-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 76819391 |
| Molecular Formula | C31H39F3N4O3Si |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxy-1-(3,4,5-trifluorophenyl)propyl]-3-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]piperidin-2-one |
| SMILES | COc1nc(C=C2CCCN(C(CCO[Si](C)(C)C(C)(C)C)c3cc(F)c(F)c(F)c3)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C31H39F3N4O3Si/c1-20-18-37(19-35-20)27-11-10-23(36-29(27)40-5)15-21-9-8-13-38(30(21)39)26(12-14-41-42(6,7)31(2,3)4)22-16-24(32)28(34)25(33)17-22/h10-11,15-19,26H,8-9,12-14H2,1-7H3 |
| InChIKey | YMSHYAZIWZKXLR-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|