C25H24F3N5O2 — CID 76819401
10-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine (PubChem CID 76819401) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is 10-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine.
| Compound Name | 10-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
|---|---|
| PubChem CID | 76819401 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 10-[[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
| SMILES | COc1nc(C=C2CCCN3C2=NOCCC3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24F3N5O2/c1-15-13-32(14-29-15)22-6-5-18(30-25(22)34-2)10-16-4-3-8-33-21(7-9-35-31-24(16)33)17-11-19(26)23(28)20(27)12-17/h5-6,10-14,21H,3-4,7-9H2,1-2H3 |
| InChIKey | RWMMAFIISOEKCE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|