C29H29F3N4O2 — CID 76819405
9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclopentane] (PubChem CID 76819405) has the molecular formula C29H29F3N4O2 and a molecular weight of 522.57 g/mol. Its IUPAC name is 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclopentane].
| Compound Name | 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 76819405 |
| Molecular Formula | C29H29F3N4O2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclopentane] |
| SMILES | COc1cc(C=C2CCCN3C2=NOC2(CCCC2)C3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C29H29F3N4O2/c1-18-16-35(17-33-18)24-8-7-19(13-25(24)37-2)12-20-6-5-11-36-27(21-14-22(30)26(32)23(31)15-21)29(9-3-4-10-29)38-34-28(20)36/h7-8,12-17,27H,3-6,9-11H2,1-2H3 |
| InChIKey | YOAIWIWJEFALAS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|