C29H24F4N4O2S — CID 123546398
(4S)-3-(5-fluorothiophen-2-yl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 123546398) has the molecular formula C29H24F4N4O2S and a molecular weight of 568.60 g/mol. Its IUPAC name is (4S)-3-(5-fluorothiophen-2-yl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S)-3-(5-fluorothiophen-2-yl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 123546398 |
| Molecular Formula | C29H24F4N4O2S |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | (4S)-3-(5-fluorothiophen-2-yl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(C=C2CCCN3C2=NOC(c2ccc(F)s2)[C@@H]3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C29H24F4N4O2S/c1-16-14-36(15-34-16)22-6-5-17(11-23(22)38-2)10-18-4-3-9-37-27(19-12-20(30)26(33)21(31)13-19)28(39-35-29(18)37)24-7-8-25(32)40-24/h5-8,10-15,27-28H,3-4,9H2,1-2H3/t27-,28?/m0/s1 |
| InChIKey | IWCQPQPNENHLKD-MBMZGMDYSA-N |
| XLogP | 7.11 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|