C28H27F3N4O2 — CID 46205552
(4S,9E)-3-cyclopropyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 46205552) has the molecular formula C28H27F3N4O2 and a molecular weight of 508.54 g/mol. Its IUPAC name is (4S,9E)-3-cyclopropyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S,9E)-3-cyclopropyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 46205552 |
| Molecular Formula | C28H27F3N4O2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (4S,9E)-3-cyclopropyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC(C2CC2)[C@@H]3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C28H27F3N4O2/c1-16-14-34(15-32-16)23-8-5-17(11-24(23)36-2)10-19-4-3-9-35-26(20-12-21(29)25(31)22(30)13-20)27(18-6-7-18)37-33-28(19)35/h5,8,10-15,18,26-27H,3-4,6-7,9H2,1-2H3/b19-10+/t26-,27?/m0/s1 |
| InChIKey | RJBCLRIPMHOFHY-MCIVIAOESA-N |
| XLogP | 5.95 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|