C28H25F3N2O2 — CID 118012079
(4S,9E)-9-[(3-methoxy-4-methylphenyl)methylidene]-3-phenyl-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 118012079) has the molecular formula C28H25F3N2O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is (4S,9E)-9-[(3-methoxy-4-methylphenyl)methylidene]-3-phenyl-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S,9E)-9-[(3-methoxy-4-methylphenyl)methylidene]-3-phenyl-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 118012079 |
| Molecular Formula | C28H25F3N2O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (4S,9E)-9-[(3-methoxy-4-methylphenyl)methylidene]-3-phenyl-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC(c2ccccc2)[C@@H]3c2cc(F)c(F)c(F)c2)ccc1C |
| InChI | InChI=1S/C28H25F3N2O2/c1-17-10-11-18(14-24(17)34-2)13-20-9-6-12-33-26(21-15-22(29)25(31)23(30)16-21)27(35-32-28(20)33)19-7-4-3-5-8-19/h3-5,7-8,10-11,13-16,26-27H,6,9,12H2,1-2H3/b20-13+/t26-,27?/m0/s1 |
| InChIKey | RQNSSXFEWIKSPJ-WYNKTDBJSA-N |
| XLogP | 6.73 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|