C23H26ClN5O3 — CID 76820964
5-[[1-[(4-chlorophenyl)methyl]-4,6-dioxo-5-propan-2-yl-1,3,5-triazinan-2-yl]amino]-2-propan-2-yloxybenzonitrile (PubChem CID 76820964) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is 5-[[1-[(4-chlorophenyl)methyl]-4,6-dioxo-5-propan-2-yl-1,3,5-triazinan-2-yl]amino]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[[1-[(4-chlorophenyl)methyl]-4,6-dioxo-5-propan-2-yl-1,3,5-triazinan-2-yl]amino]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 76820964 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 5-[[1-[(4-chlorophenyl)methyl]-4,6-dioxo-5-propan-2-yl-1,3,5-triazinan-2-yl]amino]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(NC2NC(=O)N(C(C)C)C(=O)N2Cc2ccc(Cl)cc2)cc1C#N |
| InChI | InChI=1S/C23H26ClN5O3/c1-14(2)29-22(30)27-21(28(23(29)31)13-16-5-7-18(24)8-6-16)26-19-9-10-20(32-15(3)4)17(11-19)12-25/h5-11,14-15,21,26H,13H2,1-4H3,(H,27,30) |
| InChIKey | BQMJDUFSEJEXJE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|