C28H37F3N4O2 — CID 76824474
[6-[4-[3-(ethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 76824474) has the molecular formula C28H37F3N4O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is [6-[4-[3-(ethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [6-[4-[3-(ethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 76824474 |
| Molecular Formula | C28H37F3N4O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [6-[4-[3-(ethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | CCNCCCOc1ccc(C2CCCC3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C28H37F3N4O2/c1-4-32-13-6-16-37-25-11-10-23(19(2)20(25)3)24-8-5-7-22-18-34(14-15-35(22)24)27(36)21-9-12-26(33-17-21)28(29,30)31/h9-12,17,22,24,32H,4-8,13-16,18H2,1-3H3 |
| InChIKey | DFLRRWVHQFBYEX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|