C21H26FNO5 — CID 76827982
tert-butyl 3-(ethoxymethylidene)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 76827982) has the molecular formula C21H26FNO5 and a molecular weight of 391.44 g/mol. Its IUPAC name is tert-butyl 3-(ethoxymethylidene)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 3-(ethoxymethylidene)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 76827982 |
| Molecular Formula | C21H26FNO5 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | tert-butyl 3-(ethoxymethylidene)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC=C1C(=O)c2ccc(F)cc2OC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H26FNO5/c1-5-26-13-16-18(24)15-7-6-14(22)12-17(15)27-21(16)8-10-23(11-9-21)19(25)28-20(2,3)4/h6-7,12-13H,5,8-11H2,1-4H3 |
| InChIKey | BHZGSAXYCHAEKO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|