C19H33N — CID 76830243
18-isocyanooctadeca-6,9-diene (PubChem CID 76830243) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 18-isocyanooctadeca-6,9-diene.
| Compound Name | 18-isocyanooctadeca-6,9-diene |
|---|---|
| PubChem CID | 76830243 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 18-isocyanooctadeca-6,9-diene |
| SMILES | [C-]#[N+]CCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C19H33N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-2/h7-8,10-11H,3-6,9,12-19H2,1H3 |
| InChIKey | ZNCXIYHFIWWHSM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|