About 1-isocyanooctadec-9-ene
1-isocyanooctadec-9-ene (PubChem CID 86193330) has the molecular formula C19H35N
and a molecular weight of 277.50 g/mol. Its IUPAC name is 1-isocyanooctadec-9-ene.
Molecular Properties
| Compound Name | 1-isocyanooctadec-9-ene |
| PubChem CID | 86193330 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 1-isocyanooctadec-9-ene |
| SMILES | [C-]#[N+]CCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C19H35N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-2/h10-11H,3-9,12-19H2,1H3 |
| InChIKey | XGMQMOOQAXUGPJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanooctadec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanooctadec-9-ene?
The IUPAC name of 1-isocyanooctadec-9-ene (CID 86193330) is 1-isocyanooctadec-9-ene.
What is the SMILES notation for 1-isocyanooctadec-9-ene?
The canonical SMILES for 1-isocyanooctadec-9-ene is [C-]#[N+]CCCCCCCCC=CCCCCCCCC.
What is the InChIKey of 1-isocyanooctadec-9-ene?
The InChIKey is XGMQMOOQAXUGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-2/h10-11H,3-9,12-19H2,1H3.
What are the key properties of 1-isocyanooctadec-9-ene?
1-isocyanooctadec-9-ene has a molecular weight of 277.50 g/mol, XLogP of 6.94, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanooctadec-9-ene is sourced from PubChem (CID 86193330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).