C20H20F3NO4 — CID 7683795
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate (PubChem CID 7683795) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7683795 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate |
| SMILES | CCOC(C(=O)OCC(=O)NCC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3NO4/c1-2-28-20(15-9-5-3-6-10-15,16-11-7-4-8-12-16)18(26)27-13-17(25)24-14-19(21,22)23/h3-12H,2,13-14H2,1H3,(H,24,25) |
| InChIKey | MXRFZSYJETVSEI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |