C23H27ClN2O3 — CID 76837994
3-[1-[2-(2-chlorophenyl)ethyl-(3-hydroxypropyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76837994) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 3-[1-[2-(2-chlorophenyl)ethyl-(3-hydroxypropyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-(2-chlorophenyl)ethyl-(3-hydroxypropyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76837994 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[1-[2-(2-chlorophenyl)ethyl-(3-hydroxypropyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)CCC2N(CCCO)CCc1ccccc1Cl)NO |
| InChI | InChI=1S/C23H27ClN2O3/c24-21-5-2-1-4-18(21)12-14-26(13-3-15-27)22-10-8-19-16-17(6-9-20(19)22)7-11-23(28)25-29/h1-2,4-7,9,11,16,22,27,29H,3,8,10,12-15H2,(H,25,28) |
| InChIKey | WBVLTPRNKBIRGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|