C17H18N4O5S — CID 76845046
3-[(Z)-C-pyridin-2-yl-N-(pyridin-2-ylamino)carbonimidoyl]benzenesulfonic acid;dihydrate (PubChem CID 76845046) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 3-[(Z)-C-pyridin-2-yl-N-(pyridin-2-ylamino)carbonimidoyl]benzenesulfonic acid;dihydrate.
| Compound Name | 3-[(Z)-C-pyridin-2-yl-N-(pyridin-2-ylamino)carbonimidoyl]benzenesulfonic acid;dihydrate |
|---|---|
| PubChem CID | 76845046 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-[(Z)-C-pyridin-2-yl-N-(pyridin-2-ylamino)carbonimidoyl]benzenesulfonic acid;dihydrate |
| SMILES | O.O.O=S(=O)(O)c1cccc(/C(=N/Nc2ccccn2)c2ccccn2)c1 |
| InChI | InChI=1S/C17H14N4O3S.2H2O/c22-25(23,24)14-7-5-6-13(12-14)17(15-8-1-3-10-18-15)21-20-16-9-2-4-11-19-16;;/h1-12H,(H,19,20)(H,22,23,24);2*1H2/b21-17-;; |
| InChIKey | GINQVBKQORLPJU-ZZTUKWCFSA-N |
| XLogP | 0.94 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|