C10H11N3O3 — CID 76845143
2-amino-6,7-dimethoxy-6H-quinazolin-4-one (PubChem CID 76845143) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-amino-6,7-dimethoxy-6H-quinazolin-4-one.
| Compound Name | 2-amino-6,7-dimethoxy-6H-quinazolin-4-one |
|---|---|
| PubChem CID | 76845143 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-amino-6,7-dimethoxy-6H-quinazolin-4-one |
| SMILES | COC1=CC2=NC(N)=NC(=O)C2=CC1OC |
| InChI | InChI=1S/C10H11N3O3/c1-15-7-3-5-6(4-8(7)16-2)12-10(11)13-9(5)14/h3-4,7H,1-2H3,(H2,11,13,14) |
| InChIKey | UUHNYOABSKSELG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |