C10H9ClN2O3 — CID 76845186
2-chloro-6,7-dimethoxy-6H-quinazolin-4-one (PubChem CID 76845186) has the molecular formula C10H9ClN2O3 and a molecular weight of 240.65 g/mol. Its IUPAC name is 2-chloro-6,7-dimethoxy-6H-quinazolin-4-one.
| Compound Name | 2-chloro-6,7-dimethoxy-6H-quinazolin-4-one |
|---|---|
| PubChem CID | 76845186 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-chloro-6,7-dimethoxy-6H-quinazolin-4-one |
| SMILES | COC1=CC2=NC(Cl)=NC(=O)C2=CC1OC |
| InChI | InChI=1S/C10H9ClN2O3/c1-15-7-3-5-6(4-8(7)16-2)12-10(11)13-9(5)14/h3-4,7H,1-2H3 |
| InChIKey | MBEXLONKAQZHSI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|