C19H22ClN3OS — CID 76850758
3-phenylsulfanyl-5-(propylaminomethyl)-1H-indole-2-carboxamide;hydrochloride (PubChem CID 76850758) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is 3-phenylsulfanyl-5-(propylaminomethyl)-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | 3-phenylsulfanyl-5-(propylaminomethyl)-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 76850758 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-phenylsulfanyl-5-(propylaminomethyl)-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCCNCc1ccc2[nH]c(C(N)=O)c(Sc3ccccc3)c2c1.Cl |
| InChI | InChI=1S/C19H21N3OS.ClH/c1-2-10-21-12-13-8-9-16-15(11-13)18(17(22-16)19(20)23)24-14-6-4-3-5-7-14;/h3-9,11,21-22H,2,10,12H2,1H3,(H2,20,23);1H |
| InChIKey | ADCCNUHTDVQPKC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|