C23H30N4O2S — CID 7685135
N'-[2-(3-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxamide (PubChem CID 7685135) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is N'-[2-(3-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxamide.
| Compound Name | N'-[2-(3-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxamide |
|---|---|
| PubChem CID | 7685135 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N'-[2-(3-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxamide |
| SMILES | Cc1cccc(-n2nc3c(c2NC(=O)C(=O)N[C@H]2C[C@H](C)CC(C)(C)C2)CSC3)c1 |
| InChI | InChI=1S/C23H30N4O2S/c1-14-6-5-7-17(9-14)27-20(18-12-30-13-19(18)26-27)25-22(29)21(28)24-16-8-15(2)10-23(3,4)11-16/h5-7,9,15-16H,8,10-13H2,1-4H3,(H,24,28)(H,25,29)/t15-,16-/m0/s1 |
| InChIKey | CROZWBIFNJNGRW-HOTGVXAUSA-N |
| XLogP | 4.20 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|