C18H15Cl2N3O3 — CID 76852796
5-chloro-N-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 76852796) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is 5-chloro-N-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 76852796 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 5-chloro-N-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)OCCO1)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-13-3-1-12(2-4-13)18(25-5-6-26-18)10-22-17(24)14-7-11-8-16(20)21-9-15(11)23-14/h1-4,7-9,23H,5-6,10H2,(H,22,24) |
| InChIKey | WNVJJRDKVDRBDE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|