C23H43NO4 — CID 76853342
methyl 8-[4-(2-hydroxyoctyl)-3-propyl-4,5-dihydro-1,2-oxazol-5-yl]octanoate (PubChem CID 76853342) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is methyl 8-[4-(2-hydroxyoctyl)-3-propyl-4,5-dihydro-1,2-oxazol-5-yl]octanoate.
| Compound Name | methyl 8-[4-(2-hydroxyoctyl)-3-propyl-4,5-dihydro-1,2-oxazol-5-yl]octanoate |
|---|---|
| PubChem CID | 76853342 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | methyl 8-[4-(2-hydroxyoctyl)-3-propyl-4,5-dihydro-1,2-oxazol-5-yl]octanoate |
| SMILES | CCCCCCC(O)CC1C(CCC)=NOC1CCCCCCCC(=O)OC |
| InChI | InChI=1S/C23H43NO4/c1-4-6-7-11-15-19(25)18-20-21(14-5-2)24-28-22(20)16-12-9-8-10-13-17-23(26)27-3/h19-20,22,25H,4-18H2,1-3H3 |
| InChIKey | KARMEZUHQBQJLS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|