C14H10Cl2FNO — CID 76856168
N-[(2,6-dichlorophenyl)methoxy]-1-(4-fluorophenyl)methanimine (PubChem CID 76856168) has the molecular formula C14H10Cl2FNO and a molecular weight of 298.14 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methoxy]-1-(4-fluorophenyl)methanimine.
| Compound Name | N-[(2,6-dichlorophenyl)methoxy]-1-(4-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 76856168 |
| Molecular Formula | C14H10Cl2FNO |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methoxy]-1-(4-fluorophenyl)methanimine |
| SMILES | Fc1ccc(C=NOCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2FNO/c15-13-2-1-3-14(16)12(13)9-19-18-8-10-4-6-11(17)7-5-10/h1-8H,9H2 |
| InChIKey | JKXUALBJDYLEKI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|