C18H25N3O5S — CID 7685998
ethyl 4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]piperazine-1-carboxylate (PubChem CID 7685998) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl 4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7685998 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cccc(N3CCCCS3(=O)=O)c2)CC1 |
| InChI | InChI=1S/C18H25N3O5S/c1-2-26-18(23)20-11-9-19(10-12-20)17(22)15-6-5-7-16(14-15)21-8-3-4-13-27(21,24)25/h5-7,14H,2-4,8-13H2,1H3 |
| InChIKey | DUAAUHAXTAQGBU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |