C21H25N3O3S — CID 7659007
[3-(1,1-dioxothiazinan-2-yl)phenyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 7659007) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is [3-(1,1-dioxothiazinan-2-yl)phenyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [3-(1,1-dioxothiazinan-2-yl)phenyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 7659007 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [3-(1,1-dioxothiazinan-2-yl)phenyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cccc(N2CCCCS2(=O)=O)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3O3S/c25-21(23-14-12-22(13-15-23)19-8-2-1-3-9-19)18-7-6-10-20(17-18)24-11-4-5-16-28(24,26)27/h1-3,6-10,17H,4-5,11-16H2 |
| InChIKey | OWDPWBQYAVMZHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |