C27H27FN2O4 — CID 76866561
N-[4-[1-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]ethyl]phenyl]-4-fluorobenzamide (PubChem CID 76866561) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[4-[1-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]ethyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[1-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]ethyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 76866561 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[4-[1-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]ethyl]phenyl]-4-fluorobenzamide |
| SMILES | CCOc1ccc(C=CC(=O)NC(C)c2ccc(NC(=O)c3ccc(F)cc3)cc2)cc1OC |
| InChI | InChI=1S/C27H27FN2O4/c1-4-34-24-15-5-19(17-25(24)33-3)6-16-26(31)29-18(2)20-9-13-23(14-10-20)30-27(32)21-7-11-22(28)12-8-21/h5-18H,4H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | AUOQEGTYBWYVAS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|