C13H12N2O4S — CID 768666
(E)-3-(furan-2-yl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 768666) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 768666 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C13H12N2O4S/c14-20(17,18)12-6-3-10(4-7-12)15-13(16)8-5-11-2-1-9-19-11/h1-9H,(H,15,16)(H2,14,17,18)/b8-5+ |
| InChIKey | XCNHYJUBJPXAED-VMPITWQZSA-N |
| XLogP | 1.58 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|