C22H30N4O — CID 76869053
N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 76869053) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76869053 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CC1CCCN(C(C)(C)CNC(=O)C=Cc2cnn(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C22H30N4O/c1-18-8-7-13-25(15-18)22(2,3)17-23-21(27)12-11-19-14-24-26(16-19)20-9-5-4-6-10-20/h4-6,9-12,14,16,18H,7-8,13,15,17H2,1-3H3,(H,23,27) |
| InChIKey | HDWYTAWSNBHJQZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|