C21H32N2O3 — CID 60568930
(E)-3-(3,5-dimethoxyphenyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]prop-2-enamide (PubChem CID 60568930) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 60568930 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)(C)N2CCCC(C)C2)cc(OC)c1 |
| InChI | InChI=1S/C21H32N2O3/c1-16-7-6-10-23(14-16)21(2,3)15-22-20(24)9-8-17-11-18(25-4)13-19(12-17)26-5/h8-9,11-13,16H,6-7,10,14-15H2,1-5H3,(H,22,24)/b9-8+ |
| InChIKey | LJNVAELJGIPLHG-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|