C20H21F3N2O3S2 — CID 76870802
N-[2-methyl-3-(propylsulfonylamino)phenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 76870802) has the molecular formula C20H21F3N2O3S2 and a molecular weight of 458.53 g/mol. Its IUPAC name is N-[2-methyl-3-(propylsulfonylamino)phenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-methyl-3-(propylsulfonylamino)phenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76870802 |
| Molecular Formula | C20H21F3N2O3S2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-[2-methyl-3-(propylsulfonylamino)phenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(NC(=O)C=Cc2ccc(SC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C20H21F3N2O3S2/c1-3-13-30(27,28)25-18-6-4-5-17(14(18)2)24-19(26)12-9-15-7-10-16(11-8-15)29-20(21,22)23/h4-12,25H,3,13H2,1-2H3,(H,24,26) |
| InChIKey | MPRLDOVJTUWKQR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|