C13H12F2N2O4 — CID 76876658
2,4-difluoro-5-[(6-oxopiperidine-3-carbonyl)amino]benzoic acid (PubChem CID 76876658) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2,4-difluoro-5-[(6-oxopiperidine-3-carbonyl)amino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[(6-oxopiperidine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 76876658 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2,4-difluoro-5-[(6-oxopiperidine-3-carbonyl)amino]benzoic acid |
| SMILES | O=C1CCC(C(=O)Nc2cc(C(=O)O)c(F)cc2F)CN1 |
| InChI | InChI=1S/C13H12F2N2O4/c14-8-4-9(15)10(3-7(8)13(20)21)17-12(19)6-1-2-11(18)16-5-6/h3-4,6H,1-2,5H2,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | CCBDAABJHUJFHF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |