C21H15BrN4O4 — CID 76879276
N-(5-bromo-2-pyridinyl)-3-[3-(4-nitrophenyl)prop-2-enoylamino]benzamide (PubChem CID 76879276) has the molecular formula C21H15BrN4O4 and a molecular weight of 467.28 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-3-[3-(4-nitrophenyl)prop-2-enoylamino]benzamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-3-[3-(4-nitrophenyl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 76879276 |
| Molecular Formula | C21H15BrN4O4 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-3-[3-(4-nitrophenyl)prop-2-enoylamino]benzamide |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)Nc1cccc(C(=O)Nc2ccc(Br)cn2)c1 |
| InChI | InChI=1S/C21H15BrN4O4/c22-16-7-10-19(23-13-16)25-21(28)15-2-1-3-17(12-15)24-20(27)11-6-14-4-8-18(9-5-14)26(29)30/h1-13H,(H,24,27)(H,23,25,28) |
| InChIKey | ZFLWFCRZMLZQLZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|