C8H12ClNO2 — CID 76882259
2-[3-chloroprop-2-enyl(cyclopropyl)amino]acetic acid (PubChem CID 76882259) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is 2-[3-chloroprop-2-enyl(cyclopropyl)amino]acetic acid.
| Compound Name | 2-[3-chloroprop-2-enyl(cyclopropyl)amino]acetic acid |
|---|---|
| PubChem CID | 76882259 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-[3-chloroprop-2-enyl(cyclopropyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC=CCl)C1CC1 |
| InChI | InChI=1S/C8H12ClNO2/c9-4-1-5-10(6-8(11)12)7-2-3-7/h1,4,7H,2-3,5-6H2,(H,11,12) |
| InChIKey | DJURQAKUSJYXGC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |