C22H20N6O2 — CID 76884770
2-cyano-N-(4-morpholin-4-ylphenyl)-3-(2-phenyltriazol-4-yl)prop-2-enamide (PubChem CID 76884770) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-cyano-N-(4-morpholin-4-ylphenyl)-3-(2-phenyltriazol-4-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(4-morpholin-4-ylphenyl)-3-(2-phenyltriazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76884770 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-cyano-N-(4-morpholin-4-ylphenyl)-3-(2-phenyltriazol-4-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1cnn(-c2ccccc2)n1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H20N6O2/c23-15-17(14-19-16-24-28(26-19)21-4-2-1-3-5-21)22(29)25-18-6-8-20(9-7-18)27-10-12-30-13-11-27/h1-9,14,16H,10-13H2,(H,25,29) |
| InChIKey | KLEMDDVZPRGOOY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|