C16H26N2O — CID 76888023
2-amino-3,3-dimethyl-N-(2-methyl-1-phenylpropyl)butanamide (PubChem CID 76888023) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-amino-3,3-dimethyl-N-(2-methyl-1-phenylpropyl)butanamide.
| Compound Name | 2-amino-3,3-dimethyl-N-(2-methyl-1-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 76888023 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-amino-3,3-dimethyl-N-(2-methyl-1-phenylpropyl)butanamide |
| SMILES | CC(C)C(NC(=O)C(N)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O/c1-11(2)13(12-9-7-6-8-10-12)18-15(19)14(17)16(3,4)5/h6-11,13-14H,17H2,1-5H3,(H,18,19) |
| InChIKey | HDHOKPWDKXQSNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |