C9H11ClN2O2S — CID 76899642
3-phenylpyrazolidine-4-sulfonyl chloride (PubChem CID 76899642) has the molecular formula C9H11ClN2O2S and a molecular weight of 246.72 g/mol. Its IUPAC name is 3-phenylpyrazolidine-4-sulfonyl chloride.
| Compound Name | 3-phenylpyrazolidine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 76899642 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3-phenylpyrazolidine-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1CNNC1c1ccccc1 |
| InChI | InChI=1S/C9H11ClN2O2S/c10-15(13,14)8-6-11-12-9(8)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6H2 |
| InChIKey | HTWCREBJNCZFRY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |