C22H30O3 — CID 76903299
(3R,4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 76903299) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (3R,4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (3R,4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 76903299 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (3R,4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | Cc1cc(O)cc(C(=O)[C@H]2[C@@H](C)C(=O)C[C@H]3C(C)(C)CCC[C@]23C)c1 |
| InChI | InChI=1S/C22H30O3/c1-13-9-15(11-16(23)10-13)20(25)19-14(2)17(24)12-18-21(3,4)7-6-8-22(18,19)5/h9-11,14,18-19,23H,6-8,12H2,1-5H3/t14-,18-,19+,22-/m0/s1 |
| InChIKey | VQLJHBMROIASBP-YMMPFGLASA-N |
| XLogP | 4.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |