C12H17N3O4S2 — CID 76906251
3-[2-[(2-methylpiperidin-1-yl)sulfonylamino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 76906251) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[2-[(2-methylpiperidin-1-yl)sulfonylamino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[(2-methylpiperidin-1-yl)sulfonylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906251 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-[2-[(2-methylpiperidin-1-yl)sulfonylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CC1CCCCN1S(=O)(=O)Nc1ncc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-9-4-2-3-7-15(9)21(18,19)14-12-13-8-10(20-12)5-6-11(16)17/h5-6,8-9H,2-4,7H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | YWCDAQNTQGBUBE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|