C14H13NO5 — CID 76906400
3-[3-[(3,5-dioxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 76906400) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 3-[3-[(3,5-dioxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(3,5-dioxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906400 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[3-[(3,5-dioxomorpholin-4-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(CN2C(=O)COCC2=O)c1 |
| InChI | InChI=1S/C14H13NO5/c16-12-8-20-9-13(17)15(12)7-11-3-1-2-10(6-11)4-5-14(18)19/h1-6H,7-9H2,(H,18,19) |
| InChIKey | BKLTVXBGBJLEOU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|